What is C7H8N4O2 used for?
It has a role as an adenosine receptor antagonist, a food component, a plant metabolite, a human blood serum metabolite, a mouse metabolite, a vasodilator agent and a bronchodilator agent.
What element is C7H8N4O2?
Identification of Theobromine Chemical Compound
| Chemical Formula | C7H8N4O2 |
|---|---|
| Molecular Weight | 180.16402 g/mol |
| IUPAC Name | 3,7-dimethyl-2,3,6,7-tetrahydro-1H-purine-2,6-dione |
| SMILES String | Cn1cnc2n(C)c(=O)[nH]c(=O)c12 |
| InChI | InChI=1S/C7H8N4O2/c1-10-3-8-5-4(10)6(12)9-7(13)11(5)2/h3H,1-2H3,(H,9,12,13) |
What is the chemical formula for theophylline?
C7H8N4O2
Theophylline/Formula
What chemical in chocolate makes you happy?
Theobromine. This stimulant works alongside caffeine to produce the characteristic energy boost many people experience after getting their chocolate fix. Tryptophan. An amino acid found in small quantities in chocolate used by the brain to make serotonin, the neurotransmitter that can produce feelings of happiness.
What are the effects of theobromine?
It has been reported that taking 1,500mg/day of theobromine for long durations may cause nausea, headaches, negative moods, and loss of appetite. High quantities have also caused sweating, trembling, and gastrointestinal issues in some people, similar to some of the adverse side effects of caffeine.
What is the empirical formula of c7h8n4o2?
Theobromine/Formula
What is the molar mass of c7h8n4o2?
180.164 g/mol
Theobromine/Molar mass
How is caffeine made?
Synthetic caffeine is produced by chemical synthesis of urea as a raw material, which is then combined with different chemicals such as methyl chloride and ethyl acetate. When caffeine is made synthetically, it is produced with a much higher concentration and is absorbed much faster by the body.
How does theophylline work in asthma?
Theophylline is used to prevent and treat wheezing, shortness of breath, and chest tightness caused by asthma, chronic bronchitis, emphysema, and other lung diseases. It relaxes and opens air passages in the lungs, making it easier to breathe.