What is the structure of 2 phenyl acetic acid?
C8H8O2
Phenylacetic acid/Formula
Where does phenylacetic acid come from?
Phenylacetic acid has been found to be an active auxin (a type of plant hormone), found predominantly in fruits.
What is the Iupac name of phenylacetic acid?
| IUPAC Name | 2-phenylacetic acid |
|---|---|
| Alternative Names | PHENYLACETIC ACID Benzeneacetic acid 2-Phenylacetic acid alpha-Toluic acid Phenylethanoic acid |
| Molecular Formula | C8H8O2 |
| Molar Mass | 136.15 g/mol |
| InChI | InChI=1S/C8H8O2/c9-8(10)6-7-4-2-1-3-5-7/h1-5H,6H2,(H,9,10) |
What Is phenylacetic acid derivative?
Phenylacetic acid derivatives can yield glycine and glutamine conjugates. In addition, other amino acids can be used for conjugation in various animal species, e.g. alanine and taurine, as well as some dipeptides.
What is the structure of phenyl?
Phenyl groups have six carbon atoms bonded together in a hexagonal planar ring, five of which are bonded to individual hydrogen atoms, with the remaining carbon bonded to a substituent. Phenyl groups are commonplace in organic chemistry.
What is the Colour of phenylacetic acid?
Phenylacetic acid is an organic compound containing a phenyl functional group and a carboxylic acid functional group. It is a white solid with a disagreeable odor.
Is phenylacetic acid aromatic?
Phenylacetic acid, also known as phenylacetate or alpha-toluic acid, belongs to the class of organic compounds known as benzene and substituted derivatives. These are aromatic compounds containing one monocyclic ring system consisting of benzene. Phenylacetic acid is a potentially toxic compound.
What is the pKa of phenylacetic acid?
4.31
Structure for FDB010558 (Phenylacetic acid)
| Property | Value | Reference |
|---|---|---|
| Density | Not Available | |
| Experimental logP | 1.41 | HANSCH,C ET AL. (1995) |
| Experimental pKa | pKa 4.31 (H2O) | DFC |
| Experimental Water Solubility | 16.6 mg/mL at 20 oC | CHIOU,CT et al. (1977) |
What is the structure of phenyl hydrogen?
Phenyl hydrogen phosphonate
| PubChem CID | 6327897 |
|---|---|
| Structure | Find Similar Structures |
| Molecular Formula | C6H6O3P+ |
| Synonyms | Phenyl hydrogen phosphonate 2310-89-6 hydroxy-oxo-phenoxyphosphanium Phosphonic acid, monophenyl ester EINECS 218-998-3 More… |
| Molecular Weight | 157.08 |
What is phenyl structure?
The phenyl group, or phenyl ring, is a cyclic group of atoms formed when a hydrogen atom is removed from the benzene ring. Phenyl groups have six carbon atoms in a hexagonal planar structure, of which five are bonded to hydrogen atoms.
What is the structural formula of phenol?
C6H6O
Phenol/Formula