What is the molecular composition of acetone?
Acetone is a volatile and flammable clear, colorless liquid. It is a ketone due to the presence of a carbonyl group in its structure. Its chemical formula is (CH3)2O and consists of three carbon atoms, six hydrogen atoms, and one oxygen atom.
What is the molecular name of acetone?
| IUPAC Name | propan-2-one |
|---|---|
| Alternative Names | 2-propanone propanone Dimethyl ketone |
| Molecular Formula | C3H6O |
| Molar Mass | 58.08 g/mol |
| InChI | InChI=1S/C3H6O/c1-3(2)4/h1-2H3 |
What is CH3 2CO?
Acetone (propanone) Is The Organic Compound With The Formula (CH3)2CO. It Is A Colorless, Mobile, Flammable Liquid, And Is The Simplest Ketone.
What is the molecular weight of acetone?
58.08 g/mol
Acetone/Molar mass
Is acetone ionic or molecular?
Acetone is a molecule with the molecular formula of C3H6O C 3 H 6 O . It is composed entirely of covalent bonds.
Is acetone ionic or covalent?
Why is propanone called acetone?
The first ketone this group can form is made by combining the acetyl component with CH3. Because it is the first ketone, it is called acetone. This is an old naming scheme, and the confusion it causes is one of the reasons for which chemists devised the IUPAC nomenclature.
How many atoms are in CH3 2CO?
Acetone Structure The chemical formula of acetone – (CH3)2CO can also be written as C3H6O. From this formula, it can be inferred that an acetone molecule consists of three carbon atoms, six hydrogen atoms, and one oxygen atom.
What compound is molecular?
Molecular compounds are inorganic compounds that take the form of discrete molecules. Examples include such familiar substances as water (H2O) and carbon dioxide (CO2). These compounds are very different from ionic compounds like sodium chloride (NaCl).