Is P4S7 molecular?
Phosphorus heptasulfide, free from yellow and white phosphorus appears as light-yellow crystals, light-gray powder, or fused solid….3.1Computed Properties.
| Property Name | Property Value | Reference |
|---|---|---|
| Molecular Weight | 348.4 | Computed by PubChem 2.1 (PubChem release 2021.05.07) |
What type of compound is P4S7?
Phosphorus sulfide (P4S7)
Is Phosphorus sulfide ionic or molecular?
Phosphine sulfides are formed from the reaction of organic phosphines with sulfur, in which the sulfur atom is linked to the phosphorus by a bond that has both covalent and ionic properties.
What is the compound name for P4S3?
trisulfide PHOSPHORUS SESQUISULFIDE
| IUPAC Name | |
|---|---|
| Alternative Names | Tetraphosphorus trisulfide PHOSPHORUS SESQUISULFIDE Trisulfurated phosphorus Phosphorous sesquisulfide Tetraphosphorus trisulphide |
| Molecular Formula | P4S3 |
| Molar Mass | 220.075 g/mol |
| InChI | InChI=1S/P4S3/c5-1-2-3(1)7-4(5)6-2 |
What is the correct name for N2O4?
Dinitrogen Tetraoxide
Dinitrogen tetroxide/IUPAC ID
Is sulphide a compound?
Sulfide (British English also sulphide) is an inorganic anion of sulfur with the chemical formula S2− or a compound containing one or more S2− ions. Solutions of sulfide salts are corrosive. Hydrogen sulfide (H2S) and bisulfide (SH−) are the conjugate acids of sulfide.
What is the name of P4O6?
Phosphorus trioxide
Phosphorus trioxide is the chemical compound with the molecular formula P4O6. Although the molecular formula suggests the name tetraphosphorus hexoxide, the name phosphorus trioxide preceded the knowledge of the compound’s molecular structure, and its usage continues today.
What type of bond is cl2o3?
Cl2O3 lewis structure One chlorine atom has made bonds with three oxygen atoms and from that three, two bonds double bonds. Remaining one is a single bond. Other chlorine atom has only one single bond with an oxygen atom. Both chlorine atom has joint by an oxygen atom.
What is the molecular weight of the ionic compound P4S7?
P4S7 is Tetraphosphorus heptasulfide. P = Phosphours S = Sulfur Its molecular weight is 348.35. Home Science
What does P4S7 stand for?
Phosphorus sulfide (P4S7) EINECS 234-868-9 UN1339 AI3-15015
What is the molecular weight of f4n2?
Molecular Formula: F 4 N 2: Synonyms: Tetrafluorohydrazine Dinitrogen tetrafluoride Perfluorohydrazine Nitrogen fluoride (N2F4) Hydrazine, tetrafluoro- More: Molecular Weight: 104.007 g/mol
What is the name of the compound with the formula p2f4?
Diphosphorus tetrafluoride is a gaseous compound of phosphorus and fluorine with formula P2F4. Two fluorine atoms are connected to each phosphorus atom, and there is a bond between the two phosphorus atoms.