What is citric acid chemical name?
-propanetricarboxylic acid
Citric acid
| SYNONYMS | INS No. 330 |
|---|---|
| Chemical name | 2-hydroxy-1,2,3-propanetricarboxylic acid |
| C.A.S. number | 77-92-9 (anhydrous) 5949-29-1 (monohydrate) |
| Chemical formula | C6H8O7 (anhydrous) C6H8O7. H2O (monohydrate) |
| Structural formula | Figure Anhydrous |
What is citric acid classification?
Organic compound
Tricarboxylic acid
Citric acid/Classification
Is lemon and citric acid the same?
Citric acid is named for citrus fruit, in which it’s quite prevalent. Lemon juice contains citric acid, but it also contains many other chemical compounds besides. Pure citric acid is common in nature, but is also a common food additive for its flavor and preservative properties. It has no important nutrient value.
How do you write citric acid in chemistry?
Citric Acid – C6H8O7 Citric Acid is a weak acid with a chemical formula C6H8O7. It can occur in two forms – monohydrate or water-free (anhydrous). This acid is usually found in citrus fruits like lemons, oranges etc. It is considered as a tribasic acid.
How much citric acid is in a lemon?
Lemons are among the best sources of citric acid, which is why lemon juice can often be used as a substitute for this ingredient. Each ounce of lemon juice has about 1.5 grams of citric acid, according to a study published in the Journal of Endourology in February 2009.
How many COOH groups are present in citric acid?
three carboxylic acid
Citric acid is a tricarboxylic acid with a molecular weight of 210.14 Da. In view of its three carboxylic acid functional groups, it has three pKa values at pH 3.1, 4.7, and 6.4.
What is the physical description of citric acid?
Physical properties: Citric acid is found as odorless and colorless crystals with an acidic taste. The solid has density of 1.66 g/mL, melting point of 153 °C and boiling point of 175 °C. It is highly soluble in water to give an acidic, sour tasting solution. Chemical properties: Citric acid is a weak organic acid.
Can I replace citric acid with lemon juice?
However, either can be used and they can easily be exchanged one for another. One tablespoon of bottled lemon juice is equal to 1/4 teaspoon citric acid.
Why do lemons have citric acid?
Citric acid is frequently used as a food additive to provide acidity and sour taste to foods and beverages. Among fruits, citric acid is most concentrated in lemons and limes,1 comprising as much as 8% of the dry fruit weight.
How was citric acid discovered?
Citric acid was first isolated from lemon juice by Swedish chemist Carl Wilhelm Scheele in 1784 and is manufactured by fermentation of cane sugar or molasses in the presence of a fungus, Aspergillus niger.
What is the molar mass of citric acid?
192.124 g/mol
Citric acid/Molar mass
How many grams of citric acid are in a lemon?
A typical lemon has a mass of about 150g. 150 * 5% = 7,5 g of citric acid.
What is the molecular formula for citric acid?
Citric acid PubChem CID 311 Structure Find Similar Structures Chemical Safety Laboratory Chemical Safety Summary (LCSS Molecular Formula C6H8O7 or CH2COOH-C(OH)COOH-CH2COOH Synonyms citric acid 77-92-9
Why is citric acid used as an excipient in pharmaceuticals?
Citric acid is used as an excipient in pharmaceutical preparations due to its antioxidant properties. It maintains stability of active ingredients and is used as a preservative.
What is the chemical composition of lemon essential oil?
Lemon has many bioactive components such as citric acid, Ascorbic acid, minerals, flavonoids and essential oils (5). Citrus essential oils are generally recognized as safe (GRAS) and a complex mixture of about 400 constituents consisting of 85-99% volatile and 1-15% non-volatile components (6). The volatile components