What is Isobutylbenzene used for?
Isobutylbenzene 538-93-2 is widely used in the industrial manufacture of ibuprofen, an analgesic, anti-inflammatory, over the counter painkiller. The acylation of isobutyl benzene and hydrogen fluoride is used in the synthesis of ibuprofen.
What is the structure of Isobutylbenzene?
Identification of ISOBUTYLBENZENE Chemical Compound
| Chemical Formula | C10H14 |
|---|---|
| IUPAC Name | (2-methylpropyl)benzene |
| SMILES String | CC(C)Cc1ccccc1 |
| InChI | InChI=1S/C10H14/c1-9(2)8-10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3 |
| InChIKey | KXUHSQYYJYAXGZ-UHFFFAOYSA-N |
Is Isobutylbenzene polar?
N-propyltoluene is a clear colorless liquids with an aromatic odor. Less dense than water and insoluble in water….3.1Computed Properties.
| Property Name | Property Value | Reference |
|---|---|---|
| Topological Polar Surface Area | 0 Ų | Computed by Cactvs 3.4.8.18 (PubChem release 2021.05.07) |
How do you make Isobutylbenzene?
Production of isobutylene involves the reaction of toluene with propylene in the presence of a sodium/potassium alloy (NaK2) catalyst. A mixture of isobutylene (IBB) and n-butylene (NBB) are produced with IBB predominating.
How do you make Isobutylbenzene from benzene?
Synthesis of isobutylbenzene from benzene First, a Friedel-Crafts acylation functionalizes benzene with an isobutyryl moiety (1). This substituent is reduced to an isobutyl group through a Clemmensen reduction, yielding isobutylbenzene (2).
Is azobenzene an amine?
Azobenzene is a photoswitchable chemical compound composed of two phenyl rings linked by a N=N double bond. It is the simplest example of an aryl azo compound….Azobenzene.
| Names | |
|---|---|
| ChEBI | CHEBI:58996 |
| ChEMBL | ChEMBL58835 |
| ChemSpider | 2185 |
| ECHA InfoCard | 100.002.820 |
How is ibuprofen synthesized?
Conclusion. Ibuprofen was successfully synthesized from the starting materials isobutylbenzene and acetic anhydride through a Friedel-Crafts acylation, carbonyl reduction, chloride substitution, and Grignard reaction. The structure and purity of the product were supported by IR, 1H NMR, and melting point analysis.
What is the starting material for ibuprofen?
isobutylbenzene
The starting material for the synthesis of ibuprofen is isobutylbenzene, seen below. Devise a synthesis of this compound starting from benzene and any other reagents.
What is the difference between isobutyl and sec-butyl?
The key difference between isobutyl and sec-butyl is that isobutyl group shows its branched structure at the second carbon atom of the carbon chain, whereas sec-butyl group shows its branched structure at the first carbon atom of the carbon chain. 1. “ Butyl Group .” Wikipedia, Wikimedia Foundation.
What is the common name for isobutyl?
This arrangement is known as isobutyl in common names. In systematic names, the longest chain is a propyl group formed by carbons 1, 2 and 3. Carbon 4 is a methyl group attached to the second carbon in the propyl group. This means isobutyl would be 2-methylpropyl in systematic names.
Synthesis of isobutylbenzene from benzene. First, a Friedel-Crafts acylation functionalizes benzene with an isobutyryl moiety (1). This substituent is reduced to an isobutyl group through a Clemmensen reduction, yielding isobutylbenzene (2). Mechanistically, the Friedel-Crafts acylation is a kind of electrophilic aromatic substitution.
What is the functional group of s butyl?
s-Butyl Functional Group. It is also often labelled as sec -butyl in common names. For systematic names, s -butyl is slightly more complicated. The longest chain at the point of connection is a propyl formed by carbons 2,3 and 4. Carbon 1 forms a methyl group, so the systematic name for s -butyl would be methylpropyl.